C18H12O5 — CID 90108390
1,6-diphenylhexane-1,2,3,4,5-pentone (PubChem CID 90108390) has the molecular formula C18H12O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1,6-diphenylhexane-1,2,3,4,5-pentone.
| Compound Name | 1,6-diphenylhexane-1,2,3,4,5-pentone |
|---|---|
| PubChem CID | 90108390 |
| Molecular Formula | C18H12O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1,6-diphenylhexane-1,2,3,4,5-pentone |
| SMILES | O=C(Cc1ccccc1)C(=O)C(=O)C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H12O5/c19-14(11-12-7-3-1-4-8-12)16(21)18(23)17(22)15(20)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | MMULHZAJBFIJGR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|