About (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one
(Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one (PubChem CID 139068935) has the molecular formula C22H18O2
and a molecular weight of 314.38 g/mol. Its IUPAC name is (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one |
| PubChem CID | 139068935 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(Cc1ccccc1)=C(\O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18O2/c23-21(18-12-6-2-7-13-18)20(16-17-10-4-1-5-11-17)22(24)19-14-8-3-9-15-19/h1-15,23H,16H2/b21-20- |
| InChIKey | BDPLNFOCTVUGSC-MRCUWXFGSA-N |
| XLogP | 5.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one?
The IUPAC name of (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one (CID 139068935) is (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one.
What is the SMILES notation for (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one?
The canonical SMILES for (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one is O=C(/C(Cc1ccccc1)=C(\O)c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one?
The InChIKey is BDPLNFOCTVUGSC-MRCUWXFGSA-N. The full InChI is InChI=1S/C22H18O2/c23-21(18-12-6-2-7-13-18)20(16-17-10-4-1-5-11-17)22(24)19-14-8-3-9-15-19/h1-15,23H,16H2/b21-20-.
What are the key properties of (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one?
(Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one has a molecular weight of 314.38 g/mol, XLogP of 5.08, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-benzyl-3-hydroxy-1,3-diphenylprop-2-en-1-one is sourced from PubChem (CID 139068935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).