C16H15NO — CID 57257488
2-methylimino-1,3-diphenylpropan-1-one (PubChem CID 57257488) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-methylimino-1,3-diphenylpropan-1-one.
| Compound Name | 2-methylimino-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 57257488 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-methylimino-1,3-diphenylpropan-1-one |
| SMILES | C/N=C(\Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-17-15(12-13-8-4-2-5-9-13)16(18)14-10-6-3-7-11-14/h2-11H,12H2,1H3/b17-15+ |
| InChIKey | ATQGHPSCJLDBBG-BMRADRMJSA-N |
| XLogP | 3.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|