C14H9BF4O2 — CID 71592743
(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-3,5-difluorophenyl)prop-1-en-1-ol (PubChem CID 71592743) has the molecular formula C14H9BF4O2 and a molecular weight of 296.03 g/mol. Its IUPAC name is (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-3,5-difluorophenyl)prop-1-en-1-ol.
| Compound Name | (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-3,5-difluorophenyl)prop-1-en-1-ol |
|---|---|
| PubChem CID | 71592743 |
| Molecular Formula | C14H9BF4O2 |
| Molecular Weight | 296.03 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-3,5-difluorophenyl)prop-1-en-1-ol |
| SMILES | O/C(=C\C=C1C=CC=C1)c1cc(F)cc(F)c1OB(F)F |
| InChI | InChI=1S/C14H9BF4O2/c16-10-7-11(14(12(17)8-10)21-15(18)19)13(20)6-5-9-3-1-2-4-9/h1-8,20H/b13-6- |
| InChIKey | BAELLBKSKBWJEM-MLPAPPSSSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.03 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|