C27H18BF12N3O9 — CID 168727435
tris[[(3,5-difluoro-2-methoxybenzoyl)amino]-difluoromethyl] borate (PubChem CID 168727435) has the molecular formula C27H18BF12N3O9 and a molecular weight of 767.24 g/mol. Its IUPAC name is tris[[(3,5-difluoro-2-methoxybenzoyl)amino]-difluoromethyl] borate.
| Compound Name | tris[[(3,5-difluoro-2-methoxybenzoyl)amino]-difluoromethyl] borate |
|---|---|
| PubChem CID | 168727435 |
| Molecular Formula | C27H18BF12N3O9 |
| Molecular Weight | 767.24 g/mol |
| Exact Mass | 767.09 |
| IUPAC Name | tris[[(3,5-difluoro-2-methoxybenzoyl)amino]-difluoromethyl] borate |
| SMILES | COc1c(F)cc(F)cc1C(=O)NC(F)(F)OB(OC(F)(F)NC(=O)c1cc(F)cc(F)c1OC)OC(F)(F)NC(=O)c1cc(F)cc(F)c1OC |
| InChI | InChI=1S/C27H18BF12N3O9/c1-47-19-13(4-10(29)7-16(19)32)22(44)41-25(35,36)50-28(51-26(37,38)42-23(45)14-5-11(30)8-17(33)20(14)48-2)52-27(39,40)43-24(46)15-6-12(31)9-18(34)21(15)49-3/h4-9H,1-3H3,(H,41,44)(H,42,45)(H,43,46) |
| InChIKey | JVNYJAFZNWUBFO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.24 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|