C12H10F2O3 — CID 170469797
methyl 4-(3,5-difluoro-2-methoxyphenyl)but-3-ynoate (PubChem CID 170469797) has the molecular formula C12H10F2O3 and a molecular weight of 240.20 g/mol. Its IUPAC name is methyl 4-(3,5-difluoro-2-methoxyphenyl)but-3-ynoate.
| Compound Name | methyl 4-(3,5-difluoro-2-methoxyphenyl)but-3-ynoate |
|---|---|
| PubChem CID | 170469797 |
| Molecular Formula | C12H10F2O3 |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | methyl 4-(3,5-difluoro-2-methoxyphenyl)but-3-ynoate |
| SMILES | COC(=O)CC#Cc1cc(F)cc(F)c1OC |
| InChI | InChI=1S/C12H10F2O3/c1-16-11(15)5-3-4-8-6-9(13)7-10(14)12(8)17-2/h6-7H,5H2,1-2H3 |
| InChIKey | CFQFBQGCBXQGDZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|