C12H12F2N2O4S — CID 60843938
methyl 2-[[2-(3-aminoprop-1-ynyl)-4,6-difluorophenyl]sulfonylamino]acetate (PubChem CID 60843938) has the molecular formula C12H12F2N2O4S and a molecular weight of 318.30 g/mol. Its IUPAC name is methyl 2-[[2-(3-aminoprop-1-ynyl)-4,6-difluorophenyl]sulfonylamino]acetate.
| Compound Name | methyl 2-[[2-(3-aminoprop-1-ynyl)-4,6-difluorophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 60843938 |
| Molecular Formula | C12H12F2N2O4S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | methyl 2-[[2-(3-aminoprop-1-ynyl)-4,6-difluorophenyl]sulfonylamino]acetate |
| SMILES | COC(=O)CNS(=O)(=O)c1c(F)cc(F)cc1C#CCN |
| InChI | InChI=1S/C12H12F2N2O4S/c1-20-11(17)7-16-21(18,19)12-8(3-2-4-15)5-9(13)6-10(12)14/h5-6,16H,4,7,15H2,1H3 |
| InChIKey | LXZBLGZPGPPRGG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|