C11H13F2N3O2S — CID 83023748
2-(3-aminoprop-1-ynyl)-4,6-difluoro-N',N'-dimethylbenzenesulfonohydrazide (PubChem CID 83023748) has the molecular formula C11H13F2N3O2S and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-4,6-difluoro-N',N'-dimethylbenzenesulfonohydrazide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-4,6-difluoro-N',N'-dimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 83023748 |
| Molecular Formula | C11H13F2N3O2S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-4,6-difluoro-N',N'-dimethylbenzenesulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1c(F)cc(F)cc1C#CCN |
| InChI | InChI=1S/C11H13F2N3O2S/c1-16(2)15-19(17,18)11-8(4-3-5-14)6-9(12)7-10(11)13/h6-7,15H,5,14H2,1-2H3 |
| InChIKey | APWJKZXYFGNUNQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|