C13H14F2N2O2S — CID 60845017
2-(3-aminoprop-1-ynyl)-N-cyclopropyl-4,6-difluoro-N-methylbenzenesulfonamide (PubChem CID 60845017) has the molecular formula C13H14F2N2O2S and a molecular weight of 300.33 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-N-cyclopropyl-4,6-difluoro-N-methylbenzenesulfonamide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-N-cyclopropyl-4,6-difluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60845017 |
| Molecular Formula | C13H14F2N2O2S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-N-cyclopropyl-4,6-difluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CC1)S(=O)(=O)c1c(F)cc(F)cc1C#CCN |
| InChI | InChI=1S/C13H14F2N2O2S/c1-17(11-4-5-11)20(18,19)13-9(3-2-6-16)7-10(14)8-12(13)15/h7-8,11H,4-6,16H2,1H3 |
| InChIKey | MKTSAJVZYPVOBX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|