C13H15F2NO3S — CID 60824878
2,4-difluoro-6-(4-hydroxybut-1-ynyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 60824878) has the molecular formula C13H15F2NO3S and a molecular weight of 303.33 g/mol. Its IUPAC name is 2,4-difluoro-6-(4-hydroxybut-1-ynyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2,4-difluoro-6-(4-hydroxybut-1-ynyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 60824878 |
| Molecular Formula | C13H15F2NO3S |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2,4-difluoro-6-(4-hydroxybut-1-ynyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1c(F)cc(F)cc1C#CCCO |
| InChI | InChI=1S/C13H15F2NO3S/c1-9(2)16-20(18,19)13-10(5-3-4-6-17)7-11(14)8-12(13)15/h7-9,16-17H,4,6H2,1-2H3 |
| InChIKey | ABBDGRFGBCGCSY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|