About N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide
N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide (PubChem CID 115408387) has the molecular formula C12H11F4NO3S
and a molecular weight of 325.28 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide |
| PubChem CID | 115408387 |
| Molecular Formula | C12H11F4NO3S |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(F)F)c1c(F)cc(F)cc1C#CCCO |
| InChI | InChI=1S/C12H11F4NO3S/c13-9-5-8(3-1-2-4-18)12(10(14)6-9)21(19,20)17-7-11(15)16/h5-6,11,17-18H,2,4,7H2 |
| InChIKey | HEENTAIAIFYCET-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide?
The IUPAC name of N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide (CID 115408387) is N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide?
The canonical SMILES for N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide is O=S(=O)(NCC(F)F)c1c(F)cc(F)cc1C#CCCO.
What is the InChIKey of N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide?
The InChIKey is HEENTAIAIFYCET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F4NO3S/c13-9-5-8(3-1-2-4-18)12(10(14)6-9)21(19,20)17-7-11(15)16/h5-6,11,17-18H,2,4,7H2.
What are the key properties of N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide?
N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide has a molecular weight of 325.28 g/mol, XLogP of 1.24, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-2,4-difluoro-6-(4-hydroxybut-1-ynyl)benzenesulfonamide is sourced from PubChem (CID 115408387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).