C13H14FNO3S — CID 54926202
N-cyclopropyl-4-fluoro-2-(4-hydroxybut-1-ynyl)benzenesulfonamide (PubChem CID 54926202) has the molecular formula C13H14FNO3S and a molecular weight of 283.32 g/mol. Its IUPAC name is N-cyclopropyl-4-fluoro-2-(4-hydroxybut-1-ynyl)benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-fluoro-2-(4-hydroxybut-1-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54926202 |
| Molecular Formula | C13H14FNO3S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | N-cyclopropyl-4-fluoro-2-(4-hydroxybut-1-ynyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1ccc(F)cc1C#CCCO |
| InChI | InChI=1S/C13H14FNO3S/c14-11-4-7-13(10(9-11)3-1-2-8-16)19(17,18)15-12-5-6-12/h4,7,9,12,15-16H,2,5-6,8H2 |
| InChIKey | OFRQZIHZEKLLNG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|