C12H10FN3O3S2 — CID 114913900
4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(thiadiazol-5-yl)benzenesulfonamide (PubChem CID 114913900) has the molecular formula C12H10FN3O3S2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114913900 |
| Molecular Formula | C12H10FN3O3S2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cnns1)c1ccc(F)cc1C#CCCO |
| InChI | InChI=1S/C12H10FN3O3S2/c13-10-4-5-11(9(7-10)3-1-2-6-17)21(18,19)15-12-8-14-16-20-12/h4-5,7-8,15,17H,2,6H2 |
| InChIKey | MWQYQUYDIQHELN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|