C9H5F2N3O4S2 — CID 114911881
2,6-difluoro-3-(thiadiazol-5-ylsulfamoyl)benzoic acid (PubChem CID 114911881) has the molecular formula C9H5F2N3O4S2 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2,6-difluoro-3-(thiadiazol-5-ylsulfamoyl)benzoic acid.
| Compound Name | 2,6-difluoro-3-(thiadiazol-5-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 114911881 |
| Molecular Formula | C9H5F2N3O4S2 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 2,6-difluoro-3-(thiadiazol-5-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1c(F)ccc(S(=O)(=O)Nc2cnns2)c1F |
| InChI | InChI=1S/C9H5F2N3O4S2/c10-4-1-2-5(8(11)7(4)9(15)16)20(17,18)13-6-3-12-14-19-6/h1-3,13H,(H,15,16) |
| InChIKey | IQGFGTZIOOFXPJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |