C11H9F2N3O4S — CID 60712743
2,6-difluoro-3-[(1-methylpyrazol-3-yl)sulfamoyl]benzoic acid (PubChem CID 60712743) has the molecular formula C11H9F2N3O4S and a molecular weight of 317.27 g/mol. Its IUPAC name is 2,6-difluoro-3-[(1-methylpyrazol-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 2,6-difluoro-3-[(1-methylpyrazol-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 60712743 |
| Molecular Formula | C11H9F2N3O4S |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2,6-difluoro-3-[(1-methylpyrazol-3-yl)sulfamoyl]benzoic acid |
| SMILES | Cn1ccc(NS(=O)(=O)c2ccc(F)c(C(=O)O)c2F)n1 |
| InChI | InChI=1S/C11H9F2N3O4S/c1-16-5-4-8(14-16)15-21(19,20)7-3-2-6(12)9(10(7)13)11(17)18/h2-5H,1H3,(H,14,15)(H,17,18) |
| InChIKey | UHJGDBQYURPLRQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |