C15H21N3O2S — CID 22209061
2,3,4,5,6-pentamethyl-N-(1-methylpyrazol-3-yl)benzenesulfonamide (PubChem CID 22209061) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-(1-methylpyrazol-3-yl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-(1-methylpyrazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22209061 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-(1-methylpyrazol-3-yl)benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)Nc2ccn(C)n2)c(C)c1C |
| InChI | InChI=1S/C15H21N3O2S/c1-9-10(2)12(4)15(13(5)11(9)3)21(19,20)17-14-7-8-18(6)16-14/h7-8H,1-6H3,(H,16,17) |
| InChIKey | HMJZCEOWWDGXMA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |