C12H16N4O2S — CID 79589626
4-amino-2,6-dimethyl-N-(1-methylpyrazol-3-yl)benzenesulfonamide (PubChem CID 79589626) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-amino-2,6-dimethyl-N-(1-methylpyrazol-3-yl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dimethyl-N-(1-methylpyrazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 79589626 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-amino-2,6-dimethyl-N-(1-methylpyrazol-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(N)cc(C)c1S(=O)(=O)Nc1ccn(C)n1 |
| InChI | InChI=1S/C12H16N4O2S/c1-8-6-10(13)7-9(2)12(8)19(17,18)15-11-4-5-16(3)14-11/h4-7H,13H2,1-3H3,(H,14,15) |
| InChIKey | RTJAGKMRXZWPCB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|