C11H14N4O3S — CID 60808972
5-amino-2-methoxy-N-(1-methylpyrazol-3-yl)benzenesulfonamide (PubChem CID 60808972) has the molecular formula C11H14N4O3S and a molecular weight of 282.33 g/mol. Its IUPAC name is 5-amino-2-methoxy-N-(1-methylpyrazol-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-methoxy-N-(1-methylpyrazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 60808972 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-amino-2-methoxy-N-(1-methylpyrazol-3-yl)benzenesulfonamide |
| SMILES | COc1ccc(N)cc1S(=O)(=O)Nc1ccn(C)n1 |
| InChI | InChI=1S/C11H14N4O3S/c1-15-6-5-11(13-15)14-19(16,17)10-7-8(12)3-4-9(10)18-2/h3-7H,12H2,1-2H3,(H,13,14) |
| InChIKey | SGXRHPKMGUCWDW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|