C12H16N4O3S — CID 104617067
5-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-methoxybenzenesulfonamide (PubChem CID 104617067) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 5-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 104617067 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(N)cc1S(=O)(=O)Nc1n[nH]c(C)c1C |
| InChI | InChI=1S/C12H16N4O3S/c1-7-8(2)14-15-12(7)16-20(17,18)11-6-9(13)4-5-10(11)19-3/h4-6H,13H2,1-3H3,(H2,14,15,16) |
| InChIKey | NANBRYRCOQZPMO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|