C9H12N6O2S — CID 55043689
2-(methylamino)-N-(1-methylpyrazol-3-yl)pyrimidine-5-sulfonamide (PubChem CID 55043689) has the molecular formula C9H12N6O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-(methylamino)-N-(1-methylpyrazol-3-yl)pyrimidine-5-sulfonamide.
| Compound Name | 2-(methylamino)-N-(1-methylpyrazol-3-yl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 55043689 |
| Molecular Formula | C9H12N6O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-(methylamino)-N-(1-methylpyrazol-3-yl)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)Nc2ccn(C)n2)cn1 |
| InChI | InChI=1S/C9H12N6O2S/c1-10-9-11-5-7(6-12-9)18(16,17)14-8-3-4-15(2)13-8/h3-6H,1-2H3,(H,13,14)(H,10,11,12) |
| InChIKey | VZHUVADCCWXBHY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |