C15H13BF2O3 — CID 71592750
(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methoxyphenyl)prop-1-en-1-ol (PubChem CID 71592750) has the molecular formula C15H13BF2O3 and a molecular weight of 290.07 g/mol. Its IUPAC name is (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methoxyphenyl)prop-1-en-1-ol.
| Compound Name | (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methoxyphenyl)prop-1-en-1-ol |
|---|---|
| PubChem CID | 71592750 |
| Molecular Formula | C15H13BF2O3 |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methoxyphenyl)prop-1-en-1-ol |
| SMILES | COc1ccc(OB(F)F)c(/C(O)=C/C=C2C=CC=C2)c1 |
| InChI | InChI=1S/C15H13BF2O3/c1-20-12-7-9-15(21-16(17)18)13(10-12)14(19)8-6-11-4-2-3-5-11/h2-10,19H,1H3/b14-8- |
| InChIKey | XAJWALPMPYMQLF-ZSOIEALJSA-N |
| XLogP | 3.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|