C11H14O3 — CID 115814673
1-(2,6-dimethoxyphenyl)prop-2-en-1-ol (PubChem CID 115814673) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)prop-2-en-1-ol.
| Compound Name | 1-(2,6-dimethoxyphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 115814673 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)prop-2-en-1-ol |
| SMILES | C=CC(O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C11H14O3/c1-4-8(12)11-9(13-2)6-5-7-10(11)14-3/h4-8,12H,1H2,2-3H3 |
| InChIKey | TZQGMSUEEIPUEV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|