C10H13N3O3 — CID 165492310
(1R)-2-azido-1-(2,6-dimethoxyphenyl)ethanol (PubChem CID 165492310) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is (1R)-2-azido-1-(2,6-dimethoxyphenyl)ethanol.
| Compound Name | (1R)-2-azido-1-(2,6-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 165492310 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (1R)-2-azido-1-(2,6-dimethoxyphenyl)ethanol |
| SMILES | COc1cccc(OC)c1[C@@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C10H13N3O3/c1-15-8-4-3-5-9(16-2)10(8)7(14)6-12-13-11/h3-5,7,14H,6H2,1-2H3/t7-/m0/s1 |
| InChIKey | HWGSJJWNUQNTAC-ZETCQYMHSA-N |
| XLogP | 2.05 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|