C11H15N3O — CID 83093060
(1R)-2-azido-1-(2,4,6-trimethylphenyl)ethanol (PubChem CID 83093060) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is (1R)-2-azido-1-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | (1R)-2-azido-1-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 83093060 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | (1R)-2-azido-1-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c([C@@H](O)CN=[N+]=[N-])c(C)c1 |
| InChI | InChI=1S/C11H15N3O/c1-7-4-8(2)11(9(3)5-7)10(15)6-13-14-12/h4-5,10,15H,6H2,1-3H3/t10-/m0/s1 |
| InChIKey | NEMFLQFTFXGYHG-JTQLQIEISA-N |
| XLogP | 2.96 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|