C10H13N3O — CID 83092772
(1S)-2-azido-1-(3,5-dimethylphenyl)ethanol (PubChem CID 83092772) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is (1S)-2-azido-1-(3,5-dimethylphenyl)ethanol.
| Compound Name | (1S)-2-azido-1-(3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 83092772 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (1S)-2-azido-1-(3,5-dimethylphenyl)ethanol |
| SMILES | Cc1cc(C)cc([C@H](O)CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C10H13N3O/c1-7-3-8(2)5-9(4-7)10(14)6-12-13-11/h3-5,10,14H,6H2,1-2H3/t10-/m1/s1 |
| InChIKey | STTKODYMRWIJJT-SNVBAGLBSA-N |
| XLogP | 2.65 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|