C11H17NO2 — CID 82112148
2-(hydroxyamino)-1-(2,4,6-trimethylphenyl)ethanol (PubChem CID 82112148) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(hydroxyamino)-1-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 2-(hydroxyamino)-1-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 82112148 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(hydroxyamino)-1-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(C(O)CNO)c(C)c1 |
| InChI | InChI=1S/C11H17NO2/c1-7-4-8(2)11(9(3)5-7)10(13)6-12-14/h4-5,10,12-14H,6H2,1-3H3 |
| InChIKey | AWLJGATWYJCNML-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|