C11H17NO3 — CID 82113342
2-(hydroxyamino)-1-(2-methoxy-4,5-dimethylphenyl)ethanol (PubChem CID 82113342) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-(hydroxyamino)-1-(2-methoxy-4,5-dimethylphenyl)ethanol.
| Compound Name | 2-(hydroxyamino)-1-(2-methoxy-4,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 82113342 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-(hydroxyamino)-1-(2-methoxy-4,5-dimethylphenyl)ethanol |
| SMILES | COc1cc(C)c(C)cc1C(O)CNO |
| InChI | InChI=1S/C11H17NO3/c1-7-4-9(10(13)6-12-14)11(15-3)5-8(7)2/h4-5,10,12-14H,6H2,1-3H3 |
| InChIKey | CGLYWEXTROCMMM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|