C10H15NOS — CID 116939456
amino-(2-methoxy-4,5-dimethylphenyl)methanethiol (PubChem CID 116939456) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is amino-(2-methoxy-4,5-dimethylphenyl)methanethiol.
| Compound Name | amino-(2-methoxy-4,5-dimethylphenyl)methanethiol |
|---|---|
| PubChem CID | 116939456 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | amino-(2-methoxy-4,5-dimethylphenyl)methanethiol |
| SMILES | COc1cc(C)c(C)cc1C(N)S |
| InChI | InChI=1S/C10H15NOS/c1-6-4-8(10(11)13)9(12-3)5-7(6)2/h4-5,10,13H,11H2,1-3H3 |
| InChIKey | ZNXQMMOHJCFYLC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|