C15H24N2O2 — CID 5136943
1-(2-methoxy-4,5-dimethylphenyl)-2-piperazin-1-ylethanol (PubChem CID 5136943) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(2-methoxy-4,5-dimethylphenyl)-2-piperazin-1-ylethanol.
| Compound Name | 1-(2-methoxy-4,5-dimethylphenyl)-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 5136943 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-(2-methoxy-4,5-dimethylphenyl)-2-piperazin-1-ylethanol |
| SMILES | COc1cc(C)c(C)cc1C(O)CN1CCNCC1 |
| InChI | InChI=1S/C15H24N2O2/c1-11-8-13(15(19-3)9-12(11)2)14(18)10-17-6-4-16-5-7-17/h8-9,14,16,18H,4-7,10H2,1-3H3 |
| InChIKey | STLUQOVEMJTTPY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |