C13H18N4O2 — CID 59568649
6-(1-hydroxy-2-piperazin-1-ylethyl)-4-methoxypyridine-3-carbonitrile (PubChem CID 59568649) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 6-(1-hydroxy-2-piperazin-1-ylethyl)-4-methoxypyridine-3-carbonitrile.
| Compound Name | 6-(1-hydroxy-2-piperazin-1-ylethyl)-4-methoxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59568649 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 6-(1-hydroxy-2-piperazin-1-ylethyl)-4-methoxypyridine-3-carbonitrile |
| SMILES | COc1cc(C(O)CN2CCNCC2)ncc1C#N |
| InChI | InChI=1S/C13H18N4O2/c1-19-13-6-11(16-8-10(13)7-14)12(18)9-17-4-2-15-3-5-17/h6,8,12,15,18H,2-5,9H2,1H3 |
| InChIKey | RSQMGZRULQHDJW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |