C11H14N2O2 — CID 163464520
4-ethoxy-6-(1-hydroxypropyl)pyridine-3-carbonitrile (PubChem CID 163464520) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-ethoxy-6-(1-hydroxypropyl)pyridine-3-carbonitrile.
| Compound Name | 4-ethoxy-6-(1-hydroxypropyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 163464520 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-ethoxy-6-(1-hydroxypropyl)pyridine-3-carbonitrile |
| SMILES | CCOc1cc(C(O)CC)ncc1C#N |
| InChI | InChI=1S/C11H14N2O2/c1-3-10(14)9-5-11(15-4-2)8(6-12)7-13-9/h5,7,10,14H,3-4H2,1-2H3 |
| InChIKey | BRKBGTUASIRGNQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |