C25H23Cl2N5O2 — CID 90213024
4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-(3-piperazin-1-ylprop-1-ynyl)quinoline-3-carbonitrile (PubChem CID 90213024) has the molecular formula C25H23Cl2N5O2 and a molecular weight of 496.40 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-(3-piperazin-1-ylprop-1-ynyl)quinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-(3-piperazin-1-ylprop-1-ynyl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 90213024 |
| Molecular Formula | C25H23Cl2N5O2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-(3-piperazin-1-ylprop-1-ynyl)quinoline-3-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(C#CCN4CCNCC4)c(OC)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C25H23Cl2N5O2/c1-33-23-11-18-21(10-16(23)4-3-7-32-8-5-29-6-9-32)30-15-17(14-28)25(18)31-22-13-24(34-2)20(27)12-19(22)26/h10-13,15,29H,5-9H2,1-2H3,(H,30,31) |
| InChIKey | DCRZCBSZVNETAT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|