C29H32Cl2N4O4 — CID 72695380
4-(2,4-dichloro-5-methoxyanilino)-7-[3-(2-hydroxy-7-azaspiro[3.5]nonan-7-yl)propoxy]-6-methoxyquinoline-3-carbonitrile (PubChem CID 72695380) has the molecular formula C29H32Cl2N4O4 and a molecular weight of 571.51 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-methoxyanilino)-7-[3-(2-hydroxy-7-azaspiro[3.5]nonan-7-yl)propoxy]-6-methoxyquinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dichloro-5-methoxyanilino)-7-[3-(2-hydroxy-7-azaspiro[3.5]nonan-7-yl)propoxy]-6-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 72695380 |
| Molecular Formula | C29H32Cl2N4O4 |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 4-(2,4-dichloro-5-methoxyanilino)-7-[3-(2-hydroxy-7-azaspiro[3.5]nonan-7-yl)propoxy]-6-methoxyquinoline-3-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(OCCCN4CCC5(CC4)CC(O)C5)c(OC)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C29H32Cl2N4O4/c1-37-25-13-24(21(30)11-22(25)31)34-28-18(16-32)17-33-23-12-27(26(38-2)10-20(23)28)39-9-3-6-35-7-4-29(5-8-35)14-19(36)15-29/h10-13,17,19,36H,3-9,14-15H2,1-2H3,(H,33,34) |
| InChIKey | QRGWEVFDZUVBPN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|