C37H37Cl3N6O5 — CID 130300666
7-[3-[4-[4-(5-chloro-1,3-dioxoisoindol-2-yl)butyl]piperazin-1-yl]propoxy]-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinoline-3-carbonitrile (PubChem CID 130300666) has the molecular formula C37H37Cl3N6O5 and a molecular weight of 752.10 g/mol. Its IUPAC name is 7-[3-[4-[4-(5-chloro-1,3-dioxoisoindol-2-yl)butyl]piperazin-1-yl]propoxy]-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinoline-3-carbonitrile.
| Compound Name | 7-[3-[4-[4-(5-chloro-1,3-dioxoisoindol-2-yl)butyl]piperazin-1-yl]propoxy]-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 130300666 |
| Molecular Formula | C37H37Cl3N6O5 |
| Molecular Weight | 752.10 g/mol |
| Exact Mass | 750.19 |
| IUPAC Name | 7-[3-[4-[4-(5-chloro-1,3-dioxoisoindol-2-yl)butyl]piperazin-1-yl]propoxy]-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinoline-3-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(OCCCN4CCN(CCCCN5C(=O)c6ccc(Cl)cc6C5=O)CC4)c(OC)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C37H37Cl3N6O5/c1-49-32-20-31(28(39)18-29(32)40)43-35-23(21-41)22-42-30-19-34(33(50-2)17-27(30)35)51-15-5-9-45-13-11-44(12-14-45)8-3-4-10-46-36(47)25-7-6-24(38)16-26(25)37(46)48/h6-7,16-20,22H,3-5,8-15H2,1-2H3,(H,42,43) |
| InChIKey | VTDFZZPGTZLWPY-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.10 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|