C29H32Cl2N4O5 — CID 11678731
ethyl 1-[3-[3-cyano-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinolin-7-yl]oxypropyl]piperidine-4-carboxylate (PubChem CID 11678731) has the molecular formula C29H32Cl2N4O5 and a molecular weight of 587.50 g/mol. Its IUPAC name is ethyl 1-[3-[3-cyano-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinolin-7-yl]oxypropyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[3-cyano-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinolin-7-yl]oxypropyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 11678731 |
| Molecular Formula | C29H32Cl2N4O5 |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | ethyl 1-[3-[3-cyano-4-(2,4-dichloro-5-methoxyanilino)-6-methoxyquinolin-7-yl]oxypropyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCCOc2cc3ncc(C#N)c(Nc4cc(OC)c(Cl)cc4Cl)c3cc2OC)CC1 |
| InChI | InChI=1S/C29H32Cl2N4O5/c1-4-39-29(36)18-6-9-35(10-7-18)8-5-11-40-27-14-23-20(12-26(27)38-3)28(19(16-32)17-33-23)34-24-15-25(37-2)22(31)13-21(24)30/h12-15,17-18H,4-11H2,1-3H3,(H,33,34) |
| InChIKey | RXUXNDLLFSHIKP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|