C27H32ClN5O3 — CID 118680025
4-(4-chloro-5-methoxy-2-methylanilino)-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile (PubChem CID 118680025) has the molecular formula C27H32ClN5O3 and a molecular weight of 510.04 g/mol. Its IUPAC name is 4-(4-chloro-5-methoxy-2-methylanilino)-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile.
| Compound Name | 4-(4-chloro-5-methoxy-2-methylanilino)-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 118680025 |
| Molecular Formula | C27H32ClN5O3 |
| Molecular Weight | 510.04 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 4-(4-chloro-5-methoxy-2-methylanilino)-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(OCCCN4CCN(C)CC4)c(OC)cc23)c(C)cc1Cl |
| InChI | InChI=1S/C27H32ClN5O3/c1-18-12-21(28)24(34-3)14-22(18)31-27-19(16-29)17-30-23-15-26(25(35-4)13-20(23)27)36-11-5-6-33-9-7-32(2)8-10-33/h12-15,17H,5-11H2,1-4H3,(H,30,31) |
| InChIKey | ORKXDWKGCYMBKL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.04 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|