C25H29ClN6O3 — CID 10323578
4-[(3-chloro-6-methoxy-2-pyridinyl)amino]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile (PubChem CID 10323578) has the molecular formula C25H29ClN6O3 and a molecular weight of 497.00 g/mol. Its IUPAC name is 4-[(3-chloro-6-methoxy-2-pyridinyl)amino]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile.
| Compound Name | 4-[(3-chloro-6-methoxy-2-pyridinyl)amino]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 10323578 |
| Molecular Formula | C25H29ClN6O3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 4-[(3-chloro-6-methoxy-2-pyridinyl)amino]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile |
| SMILES | COc1ccc(Cl)c(Nc2c(C#N)cnc3cc(OCCCN4CCN(C)CC4)c(OC)cc23)n1 |
| InChI | InChI=1S/C25H29ClN6O3/c1-31-8-10-32(11-9-31)7-4-12-35-22-14-20-18(13-21(22)33-2)24(17(15-27)16-28-20)30-25-19(26)5-6-23(29-25)34-3/h5-6,13-14,16H,4,7-12H2,1-3H3,(H,28,29,30) |
| InChIKey | BSFVXLVHTDWZKC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|