C26H28Cl2N5O3- — CID 142167880
2,4-dichloro-5-[[3-cyano-7-[3-(4-ethylpiperazin-1-yl)propoxy]-6-methoxyquinolin-4-yl]amino]phenolate (PubChem CID 142167880) has the molecular formula C26H28Cl2N5O3- and a molecular weight of 529.45 g/mol. Its IUPAC name is 2,4-dichloro-5-[[3-cyano-7-[3-(4-ethylpiperazin-1-yl)propoxy]-6-methoxyquinolin-4-yl]amino]phenolate.
| Compound Name | 2,4-dichloro-5-[[3-cyano-7-[3-(4-ethylpiperazin-1-yl)propoxy]-6-methoxyquinolin-4-yl]amino]phenolate |
|---|---|
| PubChem CID | 142167880 |
| Molecular Formula | C26H28Cl2N5O3- |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2,4-dichloro-5-[[3-cyano-7-[3-(4-ethylpiperazin-1-yl)propoxy]-6-methoxyquinolin-4-yl]amino]phenolate |
| SMILES | CCN1CCN(CCCOc2cc3ncc(C#N)c(Nc4cc([O-])c(Cl)cc4Cl)c3cc2OC)CC1 |
| InChI | InChI=1S/C26H29Cl2N5O3/c1-3-32-6-8-33(9-7-32)5-4-10-36-25-14-21-18(11-24(25)35-2)26(17(15-29)16-30-21)31-22-13-23(34)20(28)12-19(22)27/h11-14,16,34H,3-10H2,1-2H3,(H,30,31)/p-1 |
| InChIKey | MPSFSVDXZNCRMH-UHFFFAOYSA-M |
| XLogP | 4.65 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|