C25H26Cl2N6O4 — CID 171379934
4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-[3-(4-nitrosopiperazin-1-yl)propoxy]quinoline-3-carbonitrile (PubChem CID 171379934) has the molecular formula C25H26Cl2N6O4 and a molecular weight of 545.43 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-[3-(4-nitrosopiperazin-1-yl)propoxy]quinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-[3-(4-nitrosopiperazin-1-yl)propoxy]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 171379934 |
| Molecular Formula | C25H26Cl2N6O4 |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-[3-(4-nitrosopiperazin-1-yl)propoxy]quinoline-3-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(OCCCN4CCN(N=O)CC4)c(OC)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C25H26Cl2N6O4/c1-35-22-13-21(18(26)11-19(22)27)30-25-16(14-28)15-29-20-12-24(23(36-2)10-17(20)25)37-9-3-4-32-5-7-33(31-34)8-6-32/h10-13,15H,3-9H2,1-2H3,(H,29,30) |
| InChIKey | FFRRNQBYFRBZFE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|