C23H17Cl2N5O3 — CID 23437849
4-(2,4-dichloro-5-methoxyanilino)-7-(2-formyl-3-methylimidazol-4-yl)-6-methoxyquinoline-3-carbonitrile (PubChem CID 23437849) has the molecular formula C23H17Cl2N5O3 and a molecular weight of 482.33 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-methoxyanilino)-7-(2-formyl-3-methylimidazol-4-yl)-6-methoxyquinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dichloro-5-methoxyanilino)-7-(2-formyl-3-methylimidazol-4-yl)-6-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23437849 |
| Molecular Formula | C23H17Cl2N5O3 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 4-(2,4-dichloro-5-methoxyanilino)-7-(2-formyl-3-methylimidazol-4-yl)-6-methoxyquinoline-3-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(-c4cnc(C=O)n4C)c(OC)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C23H17Cl2N5O3/c1-30-19(10-28-22(30)11-31)14-4-17-13(5-20(14)32-2)23(12(8-26)9-27-17)29-18-7-21(33-3)16(25)6-15(18)24/h4-7,9-11H,1-3H3,(H,27,29) |
| InChIKey | SIDDMCGWLBQEPH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|