C23H15Cl2N3O — CID 141040646
4-(2,4-dichloro-5-methoxyanilino)-7-phenylquinoline-3-carbonitrile (PubChem CID 141040646) has the molecular formula C23H15Cl2N3O and a molecular weight of 420.30 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-methoxyanilino)-7-phenylquinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dichloro-5-methoxyanilino)-7-phenylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 141040646 |
| Molecular Formula | C23H15Cl2N3O |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 4-(2,4-dichloro-5-methoxyanilino)-7-phenylquinoline-3-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(-c4ccccc4)ccc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C23H15Cl2N3O/c1-29-22-11-21(18(24)10-19(22)25)28-23-16(12-26)13-27-20-9-15(7-8-17(20)23)14-5-3-2-4-6-14/h2-11,13H,1H3,(H,27,28) |
| InChIKey | IJIKRUIZXXRBGQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |