C25H25Cl2N3O4 — CID 143191495
4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-[(E)-1-(2-oxoethoxy)prop-1-en-2-yl]quinoline-3-carbonitrile;ethane (PubChem CID 143191495) has the molecular formula C25H25Cl2N3O4 and a molecular weight of 502.40 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-[(E)-1-(2-oxoethoxy)prop-1-en-2-yl]quinoline-3-carbonitrile;ethane.
| Compound Name | 4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-[(E)-1-(2-oxoethoxy)prop-1-en-2-yl]quinoline-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 143191495 |
| Molecular Formula | C25H25Cl2N3O4 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 4-(2,4-dichloro-5-methoxyanilino)-6-methoxy-7-[(E)-1-(2-oxoethoxy)prop-1-en-2-yl]quinoline-3-carbonitrile;ethane |
| SMILES | CC.COc1cc(Nc2c(C#N)cnc3cc(/C(C)=C/OCC=O)c(OC)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C23H19Cl2N3O4.C2H6/c1-13(12-32-5-4-29)15-6-19-16(7-21(15)30-2)23(14(10-26)11-27-19)28-20-9-22(31-3)18(25)8-17(20)24;1-2/h4,6-9,11-12H,5H2,1-3H3,(H,27,28);1-2H3/b13-12+; |
| InChIKey | UANVUAPVTGSMQH-UEIGIMKUSA-N |
| XLogP | 6.78 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|