C15H22N4O2 — CID 145096174
5-cyano-4-methoxy-N-piperidin-4-ylpyridine-2-carboxamide;ethane (PubChem CID 145096174) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 5-cyano-4-methoxy-N-piperidin-4-ylpyridine-2-carboxamide;ethane.
| Compound Name | 5-cyano-4-methoxy-N-piperidin-4-ylpyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 145096174 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 5-cyano-4-methoxy-N-piperidin-4-ylpyridine-2-carboxamide;ethane |
| SMILES | CC.COc1cc(C(=O)NC2CCNCC2)ncc1C#N |
| InChI | InChI=1S/C13H16N4O2.C2H6/c1-19-12-6-11(16-8-9(12)7-14)13(18)17-10-2-4-15-5-3-10;1-2/h6,8,10,15H,2-5H2,1H3,(H,17,18);1-2H3 |
| InChIKey | RFSMBOLYQLCYAX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |