C18H29NO — CID 82314895
2-[(2-methylcyclohexyl)amino]-1-(2,4,6-trimethylphenyl)ethanol (PubChem CID 82314895) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-[(2-methylcyclohexyl)amino]-1-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 2-[(2-methylcyclohexyl)amino]-1-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 82314895 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2-[(2-methylcyclohexyl)amino]-1-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(C(O)CNC2CCCCC2C)c(C)c1 |
| InChI | InChI=1S/C18H29NO/c1-12-9-14(3)18(15(4)10-12)17(20)11-19-16-8-6-5-7-13(16)2/h9-10,13,16-17,19-20H,5-8,11H2,1-4H3 |
| InChIKey | KCXOWQFKRMOUCH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |