C17H27NO — CID 82121821
2-(cyclopentylamino)-1-(2,3,5,6-tetramethylphenyl)ethanol (PubChem CID 82121821) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-(cyclopentylamino)-1-(2,3,5,6-tetramethylphenyl)ethanol.
| Compound Name | 2-(cyclopentylamino)-1-(2,3,5,6-tetramethylphenyl)ethanol |
|---|---|
| PubChem CID | 82121821 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2-(cyclopentylamino)-1-(2,3,5,6-tetramethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(C)c(C(O)CNC2CCCC2)c1C |
| InChI | InChI=1S/C17H27NO/c1-11-9-12(2)14(4)17(13(11)3)16(19)10-18-15-7-5-6-8-15/h9,15-16,18-19H,5-8,10H2,1-4H3 |
| InChIKey | AEQBSWCAPIJFGV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |