C16H24ClNO2 — CID 18838026
1-(4-chloro-3,5-dimethylphenoxy)-3-(cyclopentylamino)propan-2-ol (PubChem CID 18838026) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 1-(4-chloro-3,5-dimethylphenoxy)-3-(cyclopentylamino)propan-2-ol.
| Compound Name | 1-(4-chloro-3,5-dimethylphenoxy)-3-(cyclopentylamino)propan-2-ol |
|---|---|
| PubChem CID | 18838026 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-(4-chloro-3,5-dimethylphenoxy)-3-(cyclopentylamino)propan-2-ol |
| SMILES | Cc1cc(OCC(O)CNC2CCCC2)cc(C)c1Cl |
| InChI | InChI=1S/C16H24ClNO2/c1-11-7-15(8-12(2)16(11)17)20-10-14(19)9-18-13-5-3-4-6-13/h7-8,13-14,18-19H,3-6,9-10H2,1-2H3 |
| InChIKey | FONBZWNROJDBLM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |