C16H25NO4S — CID 22766012
1-(cyclopentylamino)-3-(3-methyl-4-methylsulfonylphenoxy)propan-2-ol (PubChem CID 22766012) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-(cyclopentylamino)-3-(3-methyl-4-methylsulfonylphenoxy)propan-2-ol.
| Compound Name | 1-(cyclopentylamino)-3-(3-methyl-4-methylsulfonylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 22766012 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(cyclopentylamino)-3-(3-methyl-4-methylsulfonylphenoxy)propan-2-ol |
| SMILES | Cc1cc(OCC(O)CNC2CCCC2)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C16H25NO4S/c1-12-9-15(7-8-16(12)22(2,19)20)21-11-14(18)10-17-13-5-3-4-6-13/h7-9,13-14,17-18H,3-6,10-11H2,1-2H3 |
| InChIKey | PDLVGCLUQSFHGP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |