C21H29NO5S — CID 22766044
1-[2-(3,4-dimethylphenoxy)ethylamino]-3-(3-methyl-4-methylsulfonylphenoxy)propan-2-ol (PubChem CID 22766044) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenoxy)ethylamino]-3-(3-methyl-4-methylsulfonylphenoxy)propan-2-ol.
| Compound Name | 1-[2-(3,4-dimethylphenoxy)ethylamino]-3-(3-methyl-4-methylsulfonylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 22766044 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-[2-(3,4-dimethylphenoxy)ethylamino]-3-(3-methyl-4-methylsulfonylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(OCCNCC(O)COc2ccc(S(C)(=O)=O)c(C)c2)cc1C |
| InChI | InChI=1S/C21H29NO5S/c1-15-5-6-19(11-16(15)2)26-10-9-22-13-18(23)14-27-20-7-8-21(17(3)12-20)28(4,24)25/h5-8,11-12,18,22-23H,9-10,13-14H2,1-4H3 |
| InChIKey | RTJBWWMBZZZNSW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|