C14H23NO5S — CID 13300927
4-[3-(tert-butylamino)-2-hydroxypropoxy]-2-methylsulfonylphenol (PubChem CID 13300927) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-[3-(tert-butylamino)-2-hydroxypropoxy]-2-methylsulfonylphenol.
| Compound Name | 4-[3-(tert-butylamino)-2-hydroxypropoxy]-2-methylsulfonylphenol |
|---|---|
| PubChem CID | 13300927 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-[3-(tert-butylamino)-2-hydroxypropoxy]-2-methylsulfonylphenol |
| SMILES | CC(C)(C)NCC(O)COc1ccc(O)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H23NO5S/c1-14(2,3)15-8-10(16)9-20-11-5-6-12(17)13(7-11)21(4,18)19/h5-7,10,15-17H,8-9H2,1-4H3 |
| InChIKey | WMEICIKEBUWUKH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |