C13H20FNO4 — CID 559929
4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-fluorobenzene-1,2-diol (PubChem CID 559929) has the molecular formula C13H20FNO4 and a molecular weight of 273.30 g/mol. Its IUPAC name is 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-fluorobenzene-1,2-diol.
| Compound Name | 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-fluorobenzene-1,2-diol |
|---|---|
| PubChem CID | 559929 |
| Molecular Formula | C13H20FNO4 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-fluorobenzene-1,2-diol |
| SMILES | CC(C)(C)NCC(O)COc1ccc(O)c(O)c1F |
| InChI | InChI=1S/C13H20FNO4/c1-13(2,3)15-6-8(16)7-19-10-5-4-9(17)12(18)11(10)14/h4-5,8,15-18H,6-7H2,1-3H3 |
| InChIKey | NBOURJIOPAPXKD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|